C32H38N6O2S — CID 4977663
2-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-(diethylazaniumyl)phenolate (PubChem CID 4977663) has the molecular formula C32H38N6O2S and a molecular weight of 570.76 g/mol. Its IUPAC name is 2-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-(diethylazaniumyl)phenolate.
| Compound Name | 2-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-(diethylazaniumyl)phenolate |
|---|---|
| PubChem CID | 4977663 |
| Molecular Formula | C32H38N6O2S |
| Molecular Weight | 570.76 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 2-[[[2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]-5-(diethylazaniumyl)phenolate |
| SMILES | CC[NH+](CC)c1ccc(C=NNC(=O)CSc2nnc(-c3ccc(C(C)(C)C)cc3)n2-c2ccc(C)cc2)c([O-])c1 |
| InChI | InChI=1S/C32H38N6O2S/c1-7-37(8-2)27-18-13-24(28(39)19-27)20-33-34-29(40)21-41-31-36-35-30(38(31)26-16-9-22(3)10-17-26)23-11-14-25(15-12-23)32(4,5)6/h9-20,39H,7-8,21H2,1-6H3,(H,34,40) |
| InChIKey | MNJQAMQGLLEKMI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.76 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|