C29H28F3N5OS — CID 6869713
2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 6869713) has the molecular formula C29H28F3N5OS and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6869713 |
| Molecular Formula | C29H28F3N5OS |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)N/N=C/c3ccccc3C(F)(F)F)nnc2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H28F3N5OS/c1-19-9-15-23(16-10-19)37-26(20-11-13-22(14-12-20)28(2,3)4)35-36-27(37)39-18-25(38)34-33-17-21-7-5-6-8-24(21)29(30,31)32/h5-17H,18H2,1-4H3,(H,34,38)/b33-17+ |
| InChIKey | QPPBEZOXHMURLO-ATZGPIRCSA-N |
| XLogP | 6.80 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|