C18H19N2O+ — CID 4978527
2-(3-amino-1H-isoindol-2-ium-2-yl)-1-(2,5-dimethylphenyl)ethanone (PubChem CID 4978527) has the molecular formula C18H19N2O+ and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(3-amino-1H-isoindol-2-ium-2-yl)-1-(2,5-dimethylphenyl)ethanone.
| Compound Name | 2-(3-amino-1H-isoindol-2-ium-2-yl)-1-(2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 4978527 |
| Molecular Formula | C18H19N2O+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(3-amino-1H-isoindol-2-ium-2-yl)-1-(2,5-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C)c(C(=O)C[N+]2=C(N)c3ccccc3C2)c1 |
| InChI | InChI=1S/C18H18N2O/c1-12-7-8-13(2)16(9-12)17(21)11-20-10-14-5-3-4-6-15(14)18(20)19/h3-9,19H,10-11H2,1-2H3/p+1 |
| InChIKey | WQXRJZIKXUMAFA-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|