C37H34N2O8S — CID 4978917
prop-2-enyl 2-[2-(3-ethoxy-4-phenylmethoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 4978917) has the molecular formula C37H34N2O8S and a molecular weight of 666.75 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(3-ethoxy-4-phenylmethoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[2-(3-ethoxy-4-phenylmethoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4978917 |
| Molecular Formula | C37H34N2O8S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | prop-2-enyl 2-[2-(3-ethoxy-4-phenylmethoxyphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc4c(c3)CC(C)O4)C2c2ccc(OCc3ccccc3)c(OCC)c2)nc1C |
| InChI | InChI=1S/C37H34N2O8S/c1-5-16-45-36(43)34-22(4)38-37(48-34)39-31(24-12-15-28(29(19-24)44-6-2)46-20-23-10-8-7-9-11-23)30(33(41)35(39)42)32(40)25-13-14-27-26(18-25)17-21(3)47-27/h5,7-15,18-19,21,31,40H,1,6,16-17,20H2,2-4H3 |
| InChIKey | LBDPJTIUJPUCTP-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|