C25H17N3O3 — CID 4978929
3-[2-[2-(1H-indol-3-yl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid (PubChem CID 4978929) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 3-[2-[2-(1H-indol-3-yl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid.
| Compound Name | 3-[2-[2-(1H-indol-3-yl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 4978929 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 3-[2-[2-(1H-indol-3-yl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(C=Cc3c[nH]c4ccccc34)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H17N3O3/c29-24-20-9-2-4-11-22(20)27-23(28(24)18-7-5-6-16(14-18)25(30)31)13-12-17-15-26-21-10-3-1-8-19(17)21/h1-15,26H,(H,30,31) |
| InChIKey | URDDHKMGPBWKNW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |