C13H13N5O4S — CID 4979605
2-[2-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]imino]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]acetic acid (PubChem CID 4979605) has the molecular formula C13H13N5O4S and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-[2-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]imino]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]acetic acid.
| Compound Name | 2-[2-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]imino]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]acetic acid |
|---|---|
| PubChem CID | 4979605 |
| Molecular Formula | C13H13N5O4S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]imino]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene]acetic acid |
| SMILES | C=CCN1C(=O)C(=CC(=O)O)SC1=Nc1nc[nH]c1C(=O)NC |
| InChI | InChI=1S/C13H13N5O4S/c1-3-4-18-12(22)7(5-8(19)20)23-13(18)17-10-9(11(21)14-2)15-6-16-10/h3,5-6H,1,4H2,2H3,(H,14,21)(H,15,16)(H,19,20) |
| InChIKey | JUEILTCCNFDOPA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|