C15H19BrClN3O3 — CID 4981145
1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-cyclohexylurea (PubChem CID 4981145) has the molecular formula C15H19BrClN3O3 and a molecular weight of 404.69 g/mol. Its IUPAC name is 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-cyclohexylurea.
| Compound Name | 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 4981145 |
| Molecular Formula | C15H19BrClN3O3 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 1-[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]-3-cyclohexylurea |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H19BrClN3O3/c16-10-6-7-13(12(17)8-10)23-9-14(21)19-20-15(22)18-11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H,19,21)(H2,18,20,22) |
| InChIKey | LKECZTUDZNNTJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|