C19H18BrClN2O4 — CID 4981545
N'-[2-(2-bromo-4-chlorophenoxy)propanoyl]-2-prop-2-enoxybenzohydrazide (PubChem CID 4981545) has the molecular formula C19H18BrClN2O4 and a molecular weight of 453.72 g/mol. Its IUPAC name is N'-[2-(2-bromo-4-chlorophenoxy)propanoyl]-2-prop-2-enoxybenzohydrazide.
| Compound Name | N'-[2-(2-bromo-4-chlorophenoxy)propanoyl]-2-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 4981545 |
| Molecular Formula | C19H18BrClN2O4 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | N'-[2-(2-bromo-4-chlorophenoxy)propanoyl]-2-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccccc1C(=O)NNC(=O)C(C)Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C19H18BrClN2O4/c1-3-10-26-16-7-5-4-6-14(16)19(25)23-22-18(24)12(2)27-17-9-8-13(21)11-15(17)20/h3-9,11-12H,1,10H2,2H3,(H,22,24)(H,23,25) |
| InChIKey | TYDPPJZXSLXVJG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|