C26H30N2O4S — CID 4981702
N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-(3-methylbutoxy)benzamide (PubChem CID 4981702) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4981702 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-(3-methylbutoxy)benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(OCCC(C)C)c3)cc2)c1 |
| InChI | InChI=1S/C26H30N2O4S/c1-18(2)12-13-32-24-7-5-6-21(17-24)26(29)27-22-8-10-25(11-9-22)33(30,31)28-23-15-19(3)14-20(4)16-23/h5-11,14-18,28H,12-13H2,1-4H3,(H,27,29) |
| InChIKey | BQYDAIUFZPGBEY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |