About (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide
(2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide (PubChem CID 4982256) has the molecular formula C7H7N2O4-
and a molecular weight of 183.14 g/mol. Its IUPAC name is (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide.
Molecular Properties
| Compound Name | (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide |
| PubChem CID | 4982256 |
| Molecular Formula | C7H7N2O4- |
| Molecular Weight | 183.14 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide |
| SMILES | CCOC(=O)C(=C=[N-])C=C[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N2O4/c1-2-13-7(10)6(5-8)3-4-9(11)12/h3-4H,2H2,1H3/q-1 |
| InChIKey | SKNJYNRQFUFRAJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide?
The IUPAC name of (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide (CID 4982256) is (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide.
What is the SMILES notation for (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide?
The canonical SMILES for (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide is CCOC(=O)C(=C=[N-])C=C[N+](=O)[O-].
What is the InChIKey of (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide?
The InChIKey is SKNJYNRQFUFRAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O4/c1-2-13-7(10)6(5-8)3-4-9(11)12/h3-4H,2H2,1H3/q-1.
What are the key properties of (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide?
(2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide has a molecular weight of 183.14 g/mol, XLogP of 0.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxycarbonyl-4-nitrobuta-1,3-dienylidene)azanide is sourced from PubChem (CID 4982256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).