C14H18BrN3O — CID 4983930
2-(3-bromoanilino)-N'-(cyclohexen-1-yl)acetohydrazide (PubChem CID 4983930) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-(3-bromoanilino)-N'-(cyclohexen-1-yl)acetohydrazide.
| Compound Name | 2-(3-bromoanilino)-N'-(cyclohexen-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 4983930 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-(3-bromoanilino)-N'-(cyclohexen-1-yl)acetohydrazide |
| SMILES | O=C(CNc1cccc(Br)c1)NNC1=CCCCC1 |
| InChI | InChI=1S/C14H18BrN3O/c15-11-5-4-8-13(9-11)16-10-14(19)18-17-12-6-2-1-3-7-12/h4-6,8-9,16-17H,1-3,7,10H2,(H,18,19) |
| InChIKey | SFTKPWJHGBMKOP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|