C15H21N3O — CID 5077247
N'-(cyclohexen-1-yl)-2-(4-methylanilino)acetohydrazide (PubChem CID 5077247) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N'-(cyclohexen-1-yl)-2-(4-methylanilino)acetohydrazide.
| Compound Name | N'-(cyclohexen-1-yl)-2-(4-methylanilino)acetohydrazide |
|---|---|
| PubChem CID | 5077247 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N'-(cyclohexen-1-yl)-2-(4-methylanilino)acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC2=CCCCC2)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-12-7-9-13(10-8-12)16-11-15(19)18-17-14-5-3-2-4-6-14/h5,7-10,16-17H,2-4,6,11H2,1H3,(H,18,19) |
| InChIKey | FZPZVVKKQKFLTC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|