C15H20FN3O — CID 4621880
2-(4-fluoroanilino)-N'-(2-methylcyclohexen-1-yl)acetohydrazide (PubChem CID 4621880) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N'-(2-methylcyclohexen-1-yl)acetohydrazide.
| Compound Name | 2-(4-fluoroanilino)-N'-(2-methylcyclohexen-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 4621880 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-(4-fluoroanilino)-N'-(2-methylcyclohexen-1-yl)acetohydrazide |
| SMILES | CC1=C(NNC(=O)CNc2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C15H20FN3O/c1-11-4-2-3-5-14(11)18-19-15(20)10-17-13-8-6-12(16)7-9-13/h6-9,17-18H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | XVKUWJMHGFOIAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|