C20H16N3O3- — CID 4983931
4-[[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 4983931) has the molecular formula C20H16N3O3- and a molecular weight of 346.37 g/mol. Its IUPAC name is 4-[[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4983931 |
| Molecular Formula | C20H16N3O3- |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(CNc1cccc2ccccc12)NN=Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N3O3/c24-19(23-22-12-14-8-10-16(11-9-14)20(25)26)13-21-18-7-3-5-15-4-1-2-6-17(15)18/h1-12,21H,13H2,(H,23,24)(H,25,26)/p-1 |
| InChIKey | KDRSGAHOYNISDK-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|