C20H18IN3O2 — CID 1246283
N-[(3-iodo-4-methoxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)acetamide (PubChem CID 1246283) has the molecular formula C20H18IN3O2 and a molecular weight of 459.29 g/mol. Its IUPAC name is N-[(3-iodo-4-methoxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)acetamide.
| Compound Name | N-[(3-iodo-4-methoxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
|---|---|
| PubChem CID | 1246283 |
| Molecular Formula | C20H18IN3O2 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[(3-iodo-4-methoxyphenyl)methylideneamino]-2-(naphthalen-1-ylamino)acetamide |
| SMILES | COc1ccc(C=NNC(=O)CNc2cccc3ccccc23)cc1I |
| InChI | InChI=1S/C20H18IN3O2/c1-26-19-10-9-14(11-17(19)21)12-23-24-20(25)13-22-18-8-4-6-15-5-2-3-7-16(15)18/h2-12,22H,13H2,1H3,(H,24,25) |
| InChIKey | PBYFASFNMDQSEC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|