C22H17Cl2N3O4 — CID 4984278
2-(1,3-dioxoisoindol-2-yl)ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate (PubChem CID 4984278) has the molecular formula C22H17Cl2N3O4 and a molecular weight of 458.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4984278 |
| Molecular Formula | C22H17Cl2N3O4 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H17Cl2N3O4/c1-13-18(19(24)27(25-13)12-14-6-2-5-9-17(14)23)22(30)31-11-10-26-20(28)15-7-3-4-8-16(15)21(26)29/h2-9H,10-12H2,1H3 |
| InChIKey | LTBFVFBXUJGDJY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|