C26H18Cl2N2O4 — CID 3920556
(3-oxobenzo[f]chromen-1-yl)methyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate (PubChem CID 3920556) has the molecular formula C26H18Cl2N2O4 and a molecular weight of 493.35 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 3920556 |
| Molecular Formula | C26H18Cl2N2O4 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C26H18Cl2N2O4/c1-15-23(25(28)30(29-15)13-17-7-3-5-9-20(17)27)26(32)33-14-18-12-22(31)34-21-11-10-16-6-2-4-8-19(16)24(18)21/h2-12H,13-14H2,1H3 |
| InChIKey | HNZSCZMWSADYKL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|