C25H19ClN2O3 — CID 2469675
dibenzofuran-2-yl 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 2469675) has the molecular formula C25H19ClN2O3 and a molecular weight of 430.89 g/mol. Its IUPAC name is dibenzofuran-2-yl 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | dibenzofuran-2-yl 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2469675 |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | dibenzofuran-2-yl 1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1C(=O)Oc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C25H19ClN2O3/c1-15-24(16(2)28(27-15)14-17-7-3-5-9-21(17)26)25(29)30-18-11-12-23-20(13-18)19-8-4-6-10-22(19)31-23/h3-13H,14H2,1-2H3 |
| InChIKey | PKVGVHHQIDFAQQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|