About 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate
2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate (PubChem CID 4985591) has the molecular formula C20H19NO4
and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate |
| PubChem CID | 4985591 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCCN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-2-15(14-8-4-3-5-9-14)20(24)25-13-12-21-18(22)16-10-6-7-11-17(16)19(21)23/h3-11,15H,2,12-13H2,1H3 |
| InChIKey | ATWZCHGDWRPLDI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate (CID 4985591) is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate is CCC(C(=O)OCCN1C(=O)c2ccccc2C1=O)c1ccccc1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate?
The InChIKey is ATWZCHGDWRPLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c1-2-15(14-8-4-3-5-9-14)20(24)25-13-12-21-18(22)16-10-6-7-11-17(16)19(21)23/h3-11,15H,2,12-13H2,1H3.
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate?
2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate has a molecular weight of 337.38 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)ethyl 2-phenylbutanoate is sourced from PubChem (CID 4985591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).