C20H27ClN4O2S — CID 4994572
4-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]butanamide (PubChem CID 4994572) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is 4-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]butanamide.
| Compound Name | 4-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 4994572 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]butanamide |
| SMILES | COc1cccc(Cc2nsc(N3CCC(CNC(=O)CCCCl)CC3)n2)c1 |
| InChI | InChI=1S/C20H27ClN4O2S/c1-27-17-5-2-4-16(12-17)13-18-23-20(28-24-18)25-10-7-15(8-11-25)14-22-19(26)6-3-9-21/h2,4-5,12,15H,3,6-11,13-14H2,1H3,(H,22,26) |
| InChIKey | HEKZGAZAMWCLDA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|