C23H24ClN5O4S — CID 3946345
2-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-4-nitrobenzamide (PubChem CID 3946345) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3946345 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-chloro-N-[[1-[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-4-nitrobenzamide |
| SMILES | COc1cccc(Cc2nsc(N3CCC(CNC(=O)c4ccc([N+](=O)[O-])cc4Cl)CC3)n2)c1 |
| InChI | InChI=1S/C23H24ClN5O4S/c1-33-18-4-2-3-16(11-18)12-21-26-23(34-27-21)28-9-7-15(8-10-28)14-25-22(30)19-6-5-17(29(31)32)13-20(19)24/h2-6,11,13,15H,7-10,12,14H2,1H3,(H,25,30) |
| InChIKey | LVFDKROPOYSCQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|