C24H25N5O3S — CID 42775236
(E)-N-[[1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 42775236) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is (E)-N-[[1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42775236 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (E)-N-[[1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCC1CCN(c2nc(Cc3ccccc3)ns2)CC1 |
| InChI | InChI=1S/C24H25N5O3S/c30-23(11-8-18-6-9-21(10-7-18)29(31)32)25-17-20-12-14-28(15-13-20)24-26-22(27-33-24)16-19-4-2-1-3-5-19/h1-11,20H,12-17H2,(H,25,30)/b11-8+ |
| InChIKey | SOQXGPLYKHKDFG-DHZHZOJOSA-N |
| XLogP | 4.08 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|