C20H20N6O3 — CID 121109943
(E)-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 121109943) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is (E)-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121109943 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (E)-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#Cc1nccnc1N1CCC(CNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H20N6O3/c21-13-18-20(23-10-9-22-18)25-11-7-16(8-12-25)14-24-19(27)6-3-15-1-4-17(5-2-15)26(28)29/h1-6,9-10,16H,7-8,11-12,14H2,(H,24,27)/b6-3+ |
| InChIKey | TUKGKVMSAYMBQI-ZZXKWVIFSA-N |
| XLogP | 2.30 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|