C23H24ClN5O3S — CID 42665123
4-chloro-N-[[1-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-3-nitrobenzamide (PubChem CID 42665123) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 4-chloro-N-[[1-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[[1-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42665123 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-chloro-N-[[1-[3-[(4-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]piperidin-4-yl]methyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(Cc2nsc(N3CCC(CNC(=O)c4ccc(Cl)c([N+](=O)[O-])c4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H24ClN5O3S/c1-15-2-4-16(5-3-15)12-21-26-23(33-27-21)28-10-8-17(9-11-28)14-25-22(30)18-6-7-19(24)20(13-18)29(31)32/h2-7,13,17H,8-12,14H2,1H3,(H,25,30) |
| InChIKey | JPKLVRKISPJEBB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|