C20H19ClN4O3S — CID 121109299
N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-4-chloro-3-nitrobenzamide (PubChem CID 121109299) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 121109299 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[[1-(1,3-benzothiazol-2-yl)piperidin-4-yl]methyl]-4-chloro-3-nitrobenzamide |
| SMILES | O=C(NCC1CCN(c2nc3ccccc3s2)CC1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19ClN4O3S/c21-15-6-5-14(11-17(15)25(27)28)19(26)22-12-13-7-9-24(10-8-13)20-23-16-3-1-2-4-18(16)29-20/h1-6,11,13H,7-10,12H2,(H,22,26) |
| InChIKey | JKYHPIMQAMEYEC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|