C16H22N4O4S — CID 4996645
2-(1-aminobutyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 4996645) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(1-aminobutyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminobutyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 4996645 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(1-aminobutyl)-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)co1 |
| InChI | InChI=1S/C16H22N4O4S/c1-2-3-13(17)16-20-14(10-24-16)15(21)19-9-8-11-4-6-12(7-5-11)25(18,22)23/h4-7,10,13H,2-3,8-9,17H2,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | XIFCKJBTHFJIOH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |