C17H16N4O2S — CID 4999828
1-[2-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrazolidin-1-yl]pent-4-yn-1-one (PubChem CID 4999828) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-[2-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrazolidin-1-yl]pent-4-yn-1-one.
| Compound Name | 1-[2-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrazolidin-1-yl]pent-4-yn-1-one |
|---|---|
| PubChem CID | 4999828 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[2-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)pyrazolidin-1-yl]pent-4-yn-1-one |
| SMILES | C#CCCC(=O)N1CCCN1C(=O)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H16N4O2S/c1-2-3-7-15(22)20-9-5-10-21(20)17(23)14-12-24-16(19-14)13-6-4-8-18-11-13/h1,4,6,8,11-12H,3,5,7,9-10H2 |
| InChIKey | ZODSBQOYAHHGHU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|