C18H13N6O- — CID 5001092
2-(2-methylphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate (PubChem CID 5001092) has the molecular formula C18H13N6O- and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-(2-methylphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate.
| Compound Name | 2-(2-methylphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate |
|---|---|
| PubChem CID | 5001092 |
| Molecular Formula | C18H13N6O- |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(2-methylphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate |
| SMILES | Cc1ccccc1-c1cc(C([O-])=Nc2nn[nH]n2)c2ccccc2n1 |
| InChI | InChI=1S/C18H14N6O/c1-11-6-2-3-7-12(11)16-10-14(13-8-4-5-9-15(13)19-16)17(25)20-18-21-23-24-22-18/h2-10H,1H3,(H2,20,21,22,23,24,25)/p-1 |
| InChIKey | DIJLNUZQAWEAOS-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|