C18H13N6O2- — CID 4745250
2-(3-methoxyphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate (PubChem CID 4745250) has the molecular formula C18H13N6O2- and a molecular weight of 345.34 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate.
| Compound Name | 2-(3-methoxyphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate |
|---|---|
| PubChem CID | 4745250 |
| Molecular Formula | C18H13N6O2- |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-(2H-tetrazol-5-yl)quinoline-4-carboximidate |
| SMILES | COc1cccc(-c2cc(C([O-])=Nc3nn[nH]n3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C18H14N6O2/c1-26-12-6-4-5-11(9-12)16-10-14(13-7-2-3-8-15(13)19-16)17(25)20-18-21-23-24-22-18/h2-10H,1H3,(H2,20,21,22,23,24,25)/p-1 |
| InChIKey | VJRKLONJZKHAEU-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|