C25H21N5O2 — CID 5002112
N-[1-[1-[2-(4-cyanoanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 5002112) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is N-[1-[1-[2-(4-cyanoanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | N-[1-[1-[2-(4-cyanoanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 5002112 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N-[1-[1-[2-(4-cyanoanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)c1nc2ccccc2n1CC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H21N5O2/c1-17(27-25(32)19-7-3-2-4-8-19)24-29-21-9-5-6-10-22(21)30(24)16-23(31)28-20-13-11-18(15-26)12-14-20/h2-14,17H,16H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | QPJJSHOTXUSQFG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |