C29H31N3O7S2 — CID 5006035
ethyl 4-phenyl-2-[[2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 5006035) has the molecular formula C29H31N3O7S2 and a molecular weight of 597.72 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5006035 |
| Molecular Formula | C29H31N3O7S2 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | ethyl 4-phenyl-2-[[2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nnc(-c2cc(OCC)c(OCC)c(OCC)c2)o1 |
| InChI | InChI=1S/C29H31N3O7S2/c1-5-35-21-14-19(15-22(36-6-2)25(21)37-7-3)26-31-32-29(39-26)41-17-23(33)30-27-24(28(34)38-8-4)20(16-40-27)18-12-10-9-11-13-18/h9-16H,5-8,17H2,1-4H3,(H,30,33) |
| InChIKey | KDQVUDKBOPMJJD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|