C23H18BrN3O4S2 — CID 5166709
ethyl 2-[[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 5166709) has the molecular formula C23H18BrN3O4S2 and a molecular weight of 544.45 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5166709 |
| Molecular Formula | C23H18BrN3O4S2 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | ethyl 2-[[2-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C23H18BrN3O4S2/c1-2-30-22(29)19-16(14-8-4-3-5-9-14)12-32-21(19)25-18(28)13-33-23-27-26-20(31-23)15-10-6-7-11-17(15)24/h3-12H,2,13H2,1H3,(H,25,28) |
| InChIKey | STVNIQIXQXFKJP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|