C15H25NO4S — CID 5006401
4-tert-butyl-N-(1,1-dimethoxypropan-2-yl)benzenesulfonamide (PubChem CID 5006401) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,1-dimethoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(1,1-dimethoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5006401 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-tert-butyl-N-(1,1-dimethoxypropan-2-yl)benzenesulfonamide |
| SMILES | COC(OC)C(C)NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO4S/c1-11(14(19-5)20-6)16-21(17,18)13-9-7-12(8-10-13)15(2,3)4/h7-11,14,16H,1-6H3 |
| InChIKey | DMWGUKNYJGBKCO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|