C12H16F3NO4S — CID 5165120
N-(1,1-dimethoxypropan-2-yl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 5165120) has the molecular formula C12H16F3NO4S and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5165120 |
| Molecular Formula | C12H16F3NO4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COC(OC)C(C)NS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO4S/c1-8(11(19-2)20-3)16-21(17,18)10-6-4-9(5-7-10)12(13,14)15/h4-8,11,16H,1-3H3 |
| InChIKey | NAQHBTVLAIQDHB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|