About Bepridil Hydrochloride
Bepridil Hydrochloride (PubChem CID 50088) has the molecular formula C24H35ClN2O
and a molecular weight of 403.00 g/mol. Its IUPAC name is N-benzyl-N-[3-(2-methylpropoxy)-2-pyrrolidin-1-ylpropyl]aniline;hydrochloride.
Molecular Properties
| Compound Name | Bepridil Hydrochloride |
| PubChem CID | 50088 |
| Molecular Formula | C24H35ClN2O |
| Molecular Weight | 403.00 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-benzyl-N-[3-(2-methylpropoxy)-2-pyrrolidin-1-ylpropyl]aniline;hydrochloride |
| SMILES | CC(C)COCC(CN(CC1=CC=CC=C1)C2=CC=CC=C2)N3CCCC3.Cl |
| InChI | InChI=1S/C24H34N2O.ClH/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22;/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3;1H |
| InChIKey | JXBBWYGMTNAYNM-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 15.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | 382 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Bepridil Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bepridil Hydrochloride?
The IUPAC name of Bepridil Hydrochloride (CID 50088) is N-benzyl-N-[3-(2-methylpropoxy)-2-pyrrolidin-1-ylpropyl]aniline;hydrochloride.
What is the SMILES notation for Bepridil Hydrochloride?
The canonical SMILES for Bepridil Hydrochloride is CC(C)COCC(CN(CC1=CC=CC=C1)C2=CC=CC=C2)N3CCCC3.Cl.
What is the InChIKey of Bepridil Hydrochloride?
The InChIKey is JXBBWYGMTNAYNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O.ClH/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22;/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3;1H.
What are the key properties of Bepridil Hydrochloride?
Bepridil Hydrochloride has a molecular weight of 403.00 g/mol, XLogP of not available, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Bepridil Hydrochloride is sourced from PubChem (CID 50088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).