C14H15Br3N4O2S — CID 5010107
2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,6-tribromo-4-methoxyphenyl)acetamide (PubChem CID 5010107) has the molecular formula C14H15Br3N4O2S and a molecular weight of 543.08 g/mol. Its IUPAC name is 2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,6-tribromo-4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,6-tribromo-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5010107 |
| Molecular Formula | C14H15Br3N4O2S |
| Molecular Weight | 543.08 g/mol |
| Exact Mass | 539.85 |
| IUPAC Name | 2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,6-tribromo-4-methoxyphenyl)acetamide |
| SMILES | COc1cc(Br)c(NC(=O)CSc2n[nH]c(C(C)C)n2)c(Br)c1Br |
| InChI | InChI=1S/C14H15Br3N4O2S/c1-6(2)13-19-14(21-20-13)24-5-9(22)18-12-7(15)4-8(23-3)10(16)11(12)17/h4,6H,5H2,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | FHKLFDUNMGRHIT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.08 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|