C30H31N3O2 — CID 5011021
1-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-(4-morpholin-4-ylphenyl)methanimine (PubChem CID 5011021) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-(4-morpholin-4-ylphenyl)methanimine.
| Compound Name | 1-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-(4-morpholin-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 5011021 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-(4-morpholin-4-ylphenyl)methanimine |
| SMILES | Cc1cc(/C=N/c2ccc(N3CCOCC3)cc2)c(C)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H31N3O2/c1-23-20-26(21-31-27-8-10-28(11-9-27)32-16-18-34-19-17-32)24(2)33(23)29-12-14-30(15-13-29)35-22-25-6-4-3-5-7-25/h3-15,20-21H,16-19,22H2,1-2H3/b31-21+ |
| InChIKey | RAXNWXNQOZQGBB-NJZRLIGZSA-N |
| XLogP | 6.26 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|