C38H49N3O6S — CID 5012631
1-[[2-[3-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide (PubChem CID 5012631) has the molecular formula C38H49N3O6S and a molecular weight of 675.89 g/mol. Its IUPAC name is 1-[[2-[3-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide.
| Compound Name | 1-[[2-[3-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 5012631 |
| Molecular Formula | C38H49N3O6S |
| Molecular Weight | 675.89 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | 1-[[2-[3-(benzenesulfonamido)phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-N-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCC2CCCCC2N1CC1CC(c2ccc(CO)cc2)OC(c2cccc(NS(=O)(=O)c3ccccc3)c2)O1 |
| InChI | InChI=1S/C38H49N3O6S/c1-38(2,3)39-36(43)34-21-20-27-10-7-8-15-33(27)41(34)24-31-23-35(28-18-16-26(25-42)17-19-28)47-37(46-31)29-11-9-12-30(22-29)40-48(44,45)32-13-5-4-6-14-32/h4-6,9,11-14,16-19,22,27,31,33-35,37,40,42H,7-8,10,15,20-21,23-25H2,1-3H3,(H,39,43) |
| InChIKey | AXHBZCIJRHEOOB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.89 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |