C41H49N3O6 — CID 5072658
N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide (PubChem CID 5072658) has the molecular formula C41H49N3O6 and a molecular weight of 679.86 g/mol. Its IUPAC name is N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide.
| Compound Name | N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 5072658 |
| Molecular Formula | C41H49N3O6 |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCC2CCCCC2N1CC1CC(c2ccc(CO)cc2)OC(c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O1 |
| InChI | InChI=1S/C41H49N3O6/c1-41(2,3)42-37(46)35-21-20-28-8-4-7-11-34(28)43(35)24-31-22-36(29-16-14-27(25-45)15-17-29)50-40(49-31)30-18-12-26(13-19-30)23-44-38(47)32-9-5-6-10-33(32)39(44)48/h5-6,9-10,12-19,28,31,34-36,40,45H,4,7-8,11,20-25H2,1-3H3,(H,42,46) |
| InChIKey | CPJKRDGXSHPQBJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|