C42H51N3O6 — CID 4050864
N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide (PubChem CID 4050864) has the molecular formula C42H51N3O6 and a molecular weight of 693.88 g/mol. Its IUPAC name is N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide.
| Compound Name | N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4050864 |
| Molecular Formula | C42H51N3O6 |
| Molecular Weight | 693.88 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | N-tert-butyl-1-[[2-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxamide |
| SMILES | CC1C(CN2C(C(=O)NC(C)(C)C)CCC3CCCCC32)OC(c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)OC1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H51N3O6/c1-26-36(24-44-34-12-8-5-9-29(34)21-22-35(44)38(47)43-42(2,3)4)50-41(51-37(26)30-17-15-28(25-46)16-18-30)31-19-13-27(14-20-31)23-45-39(48)32-10-6-7-11-33(32)40(45)49/h6-7,10-11,13-20,26,29,34-37,41,46H,5,8-9,12,21-25H2,1-4H3,(H,43,47) |
| InChIKey | NBCASNCFEAMZQF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.88 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|