C23H28N2O2 — CID 5012877
2-[1-(2-benzyl-2-phenylhydrazinyl)ethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 5012877) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[1-(2-benzyl-2-phenylhydrazinyl)ethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[1-(2-benzyl-2-phenylhydrazinyl)ethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 5012877 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[1-(2-benzyl-2-phenylhydrazinyl)ethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC(NN(Cc1ccccc1)c1ccccc1)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C23H28N2O2/c1-17(22-20(26)14-23(2,3)15-21(22)27)24-25(19-12-8-5-9-13-19)16-18-10-6-4-7-11-18/h4-13,17,22,24H,14-16H2,1-3H3 |
| InChIKey | IJZBBPHQBOMVBC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|