C23H15ClN2O8S — CID 5014674
[4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzenesulfonate (PubChem CID 5014674) has the molecular formula C23H15ClN2O8S and a molecular weight of 514.90 g/mol. Its IUPAC name is [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 5014674 |
| Molecular Formula | C23H15ClN2O8S |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | [4-[[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 3-nitrobenzenesulfonate |
| SMILES | COc1cc(C=C2N=C(c3cccc(Cl)c3)OC2=O)ccc1OS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15ClN2O8S/c1-32-21-11-14(10-19-23(27)33-22(25-19)15-4-2-5-16(24)12-15)8-9-20(21)34-35(30,31)18-7-3-6-17(13-18)26(28)29/h2-13H,1H3 |
| InChIKey | ZWECHDATPBNSFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 134.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|