C25H20N2O2 — CID 5016586
2-methyl-N-[[phenyl-(4-phenylphenyl)methylidene]amino]furan-3-carboxamide (PubChem CID 5016586) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-methyl-N-[[phenyl-(4-phenylphenyl)methylidene]amino]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[[phenyl-(4-phenylphenyl)methylidene]amino]furan-3-carboxamide |
|---|---|
| PubChem CID | 5016586 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-methyl-N-[[phenyl-(4-phenylphenyl)methylidene]amino]furan-3-carboxamide |
| SMILES | Cc1occc1C(=O)NN=C(c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O2/c1-18-23(16-17-29-18)25(28)27-26-24(21-10-6-3-7-11-21)22-14-12-20(13-15-22)19-8-4-2-5-9-19/h2-17H,1H3,(H,27,28) |
| InChIKey | MBAFWHHXMIRVCO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|