C24H34N2O5 — CID 5017089
2-ethoxy-3-(3-hydroxypropyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 5017089) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-ethoxy-3-(3-hydroxypropyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | 2-ethoxy-3-(3-hydroxypropyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 5017089 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-ethoxy-3-(3-hydroxypropyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(=O)NCCCN2CCCC2=O)=CC(c2ccccc2)C1CCCO |
| InChI | InChI=1S/C24H34N2O5/c1-2-30-24-19(11-7-16-27)20(18-9-4-3-5-10-18)17-21(31-24)23(29)25-13-8-15-26-14-6-12-22(26)28/h3-5,9-10,17,19-20,24,27H,2,6-8,11-16H2,1H3,(H,25,29) |
| InChIKey | KUOQZIGTDRMBAQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|