C32H46N4O8 — CID 6671674
(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671674) has the molecular formula C32H46N4O8 and a molecular weight of 614.74 g/mol. Its IUPAC name is (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671674 |
| Molecular Formula | C32H46N4O8 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NCCCN2CCCC2=O)=C[C@@H](c2c(C)n(C)n(-c3ccccc3)c2=O)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C32H46N4O8/c1-4-43-32-25(13-18-41-20-21-42-19-17-37)26(29-23(2)34(3)36(31(29)40)24-10-6-5-7-11-24)22-27(44-32)30(39)33-14-9-16-35-15-8-12-28(35)38/h5-7,10-11,22,25-26,32,37H,4,8-9,12-21H2,1-3H3,(H,33,39)/t25-,26+,32-/m0/s1 |
| InChIKey | GHZXAFNCQYSZQY-BKQYKDOASA-N |
| XLogP | 2.01 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|