C32H40FN3O7 — CID 6667246
(2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-N-[(4-fluorophenyl)methyl]-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6667246) has the molecular formula C32H40FN3O7 and a molecular weight of 597.68 g/mol. Its IUPAC name is (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-N-[(4-fluorophenyl)methyl]-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-N-[(4-fluorophenyl)methyl]-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6667246 |
| Molecular Formula | C32H40FN3O7 |
| Molecular Weight | 597.68 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | (2S,3S,4R)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-N-[(4-fluorophenyl)methyl]-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NCc2ccc(F)cc2)=C[C@@H](c2c(C)n(C)n(-c3ccccc3)c2=O)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C32H40FN3O7/c1-4-42-32-26(14-16-40-18-19-41-17-15-37)27(20-28(43-32)30(38)34-21-23-10-12-24(33)13-11-23)29-22(2)35(3)36(31(29)39)25-8-6-5-7-9-25/h5-13,20,26-27,32,37H,4,14-19,21H2,1-3H3,(H,34,38)/t26-,27+,32-/m0/s1 |
| InChIKey | CVYBUDBURNZINM-XKVZAPNPSA-N |
| XLogP | 3.33 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|