C36H46N4O8 — CID 6668848
(2R,3S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668848) has the molecular formula C36H46N4O8 and a molecular weight of 662.78 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668848 |
| Molecular Formula | C36H46N4O8 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.33 |
| IUPAC Name | (2R,3S,4S)-4-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCc2c[nH]c3ccc(OC)cc23)=C[C@H](c2c(C)n(C)n(-c3ccccc3)c2=O)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C36H46N4O8/c1-5-47-36-28(14-17-45-19-20-46-18-16-41)30(33-24(2)39(3)40(35(33)43)26-9-7-6-8-10-26)22-32(48-36)34(42)37-15-13-25-23-38-31-12-11-27(44-4)21-29(25)31/h6-12,21-23,28,30,36,38,41H,5,13-20H2,1-4H3,(H,37,42)/t28-,30-,36+/m0/s1 |
| InChIKey | AMOPZWKRSNQUFK-MPCNFJCNSA-N |
| XLogP | 3.73 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|