C14H13ClINO2S — CID 5017106
3-chloro-N-[(3-iodophenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 5017106) has the molecular formula C14H13ClINO2S and a molecular weight of 421.69 g/mol. Its IUPAC name is 3-chloro-N-[(3-iodophenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[(3-iodophenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5017106 |
| Molecular Formula | C14H13ClINO2S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | 3-chloro-N-[(3-iodophenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cccc(I)c2)cc1Cl |
| InChI | InChI=1S/C14H13ClINO2S/c1-10-5-6-13(8-14(10)15)20(18,19)17-9-11-3-2-4-12(16)7-11/h2-8,17H,9H2,1H3 |
| InChIKey | LNHDDKZHJQINGV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|