C17H20ClNO3S — CID 39655236
3-chloro-N-[[4-(ethoxymethyl)phenyl]methyl]-4-methylbenzenesulfonamide (PubChem CID 39655236) has the molecular formula C17H20ClNO3S and a molecular weight of 353.87 g/mol. Its IUPAC name is 3-chloro-N-[[4-(ethoxymethyl)phenyl]methyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[[4-(ethoxymethyl)phenyl]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39655236 |
| Molecular Formula | C17H20ClNO3S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-chloro-N-[[4-(ethoxymethyl)phenyl]methyl]-4-methylbenzenesulfonamide |
| SMILES | CCOCc1ccc(CNS(=O)(=O)c2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H20ClNO3S/c1-3-22-12-15-7-5-14(6-8-15)11-19-23(20,21)16-9-4-13(2)17(18)10-16/h4-10,19H,3,11-12H2,1-2H3 |
| InChIKey | CZESRMNPQOYKQP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |