C16H17Cl2NO3S — CID 35616347
3,5-dichloro-N-[[4-(ethoxymethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 35616347) has the molecular formula C16H17Cl2NO3S and a molecular weight of 374.29 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-(ethoxymethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[[4-(ethoxymethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35616347 |
| Molecular Formula | C16H17Cl2NO3S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3,5-dichloro-N-[[4-(ethoxymethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CCOCc1ccc(CNS(=O)(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2NO3S/c1-2-22-11-13-5-3-12(4-6-13)10-19-23(20,21)16-8-14(17)7-15(18)9-16/h3-9,19H,2,10-11H2,1H3 |
| InChIKey | BBBQDSSLLXCKAF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |